C22H26NO4- — CID 91928942
2,4-dibenzyl-5-(3-hydroxypropylamino)-5-oxopentanoate (PubChem CID 91928942) has the molecular formula C22H26NO4- and a molecular weight of 368.45 g/mol. Its IUPAC name is 2,4-dibenzyl-5-(3-hydroxypropylamino)-5-oxopentanoate.
| Compound Name | 2,4-dibenzyl-5-(3-hydroxypropylamino)-5-oxopentanoate |
|---|---|
| PubChem CID | 91928942 |
| Molecular Formula | C22H26NO4- |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 2,4-dibenzyl-5-(3-hydroxypropylamino)-5-oxopentanoate |
| SMILES | O=C([O-])C(Cc1ccccc1)CC(Cc1ccccc1)C(=O)NCCCO |
| InChI | InChI=1S/C22H27NO4/c24-13-7-12-23-21(25)19(14-17-8-3-1-4-9-17)16-20(22(26)27)15-18-10-5-2-6-11-18/h1-6,8-11,19-20,24H,7,12-16H2,(H,23,25)(H,26,27)/p-1 |
| InChIKey | QAZJFVWJXZJTMB-UHFFFAOYSA-M |
| XLogP | 1.34 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|