C26H26NO5- — CID 91928944
(2S,4S)-2,4-dibenzyl-5-[(3,4-dihydroxyphenyl)methylamino]-5-oxopentanoate (PubChem CID 91928944) has the molecular formula C26H26NO5- and a molecular weight of 432.50 g/mol. Its IUPAC name is (2S,4S)-2,4-dibenzyl-5-[(3,4-dihydroxyphenyl)methylamino]-5-oxopentanoate.
| Compound Name | (2S,4S)-2,4-dibenzyl-5-[(3,4-dihydroxyphenyl)methylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 91928944 |
| Molecular Formula | C26H26NO5- |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | (2S,4S)-2,4-dibenzyl-5-[(3,4-dihydroxyphenyl)methylamino]-5-oxopentanoate |
| SMILES | O=C([O-])[C@H](Cc1ccccc1)C[C@@H](Cc1ccccc1)C(=O)NCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C26H27NO5/c28-23-12-11-20(15-24(23)29)17-27-25(30)21(13-18-7-3-1-4-8-18)16-22(26(31)32)14-19-9-5-2-6-10-19/h1-12,15,21-22,28-29H,13-14,16-17H2,(H,27,30)(H,31,32)/p-1/t21-,22-/m1/s1 |
| InChIKey | GHIHAGHQXIQPOK-FGZHOGPDSA-M |
| XLogP | 2.57 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|