C19H22O2S — CID 18533017
2-(benzylsulfanylmethyl)-5-phenylpentanoic acid (PubChem CID 18533017) has the molecular formula C19H22O2S and a molecular weight of 314.45 g/mol. Its IUPAC name is 2-(benzylsulfanylmethyl)-5-phenylpentanoic acid.
| Compound Name | 2-(benzylsulfanylmethyl)-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 18533017 |
| Molecular Formula | C19H22O2S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 2-(benzylsulfanylmethyl)-5-phenylpentanoic acid |
| SMILES | O=C(O)C(CCCc1ccccc1)CSCc1ccccc1 |
| InChI | InChI=1S/C19H22O2S/c20-19(21)18(13-7-12-16-8-3-1-4-9-16)15-22-14-17-10-5-2-6-11-17/h1-6,8-11,18H,7,12-15H2,(H,20,21) |
| InChIKey | WEHIQENCAZPXLL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |