C20H22O3S — CID 18533076
2-[(4-acetylphenyl)sulfanylmethyl]-5-phenylpentanoic acid (PubChem CID 18533076) has the molecular formula C20H22O3S and a molecular weight of 342.46 g/mol. Its IUPAC name is 2-[(4-acetylphenyl)sulfanylmethyl]-5-phenylpentanoic acid.
| Compound Name | 2-[(4-acetylphenyl)sulfanylmethyl]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 18533076 |
| Molecular Formula | C20H22O3S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 2-[(4-acetylphenyl)sulfanylmethyl]-5-phenylpentanoic acid |
| SMILES | CC(=O)c1ccc(SCC(CCCc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C20H22O3S/c1-15(21)17-10-12-19(13-11-17)24-14-18(20(22)23)9-5-8-16-6-3-2-4-7-16/h2-4,6-7,10-13,18H,5,8-9,14H2,1H3,(H,22,23) |
| InChIKey | UDUZLYJDDFXTHW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |