C23H25O4PS — CID 57098796
2-[[hydroxy(naphthalen-2-ylsulfanylmethyl)phosphoryl]methyl]-5-phenylpentanoic acid (PubChem CID 57098796) has the molecular formula C23H25O4PS and a molecular weight of 428.49 g/mol. Its IUPAC name is 2-[[hydroxy(naphthalen-2-ylsulfanylmethyl)phosphoryl]methyl]-5-phenylpentanoic acid.
| Compound Name | 2-[[hydroxy(naphthalen-2-ylsulfanylmethyl)phosphoryl]methyl]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 57098796 |
| Molecular Formula | C23H25O4PS |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 2-[[hydroxy(naphthalen-2-ylsulfanylmethyl)phosphoryl]methyl]-5-phenylpentanoic acid |
| SMILES | O=C(O)C(CCCc1ccccc1)CP(=O)(O)CSc1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H25O4PS/c24-23(25)21(12-6-9-18-7-2-1-3-8-18)16-28(26,27)17-29-22-14-13-19-10-4-5-11-20(19)15-22/h1-5,7-8,10-11,13-15,21H,6,9,12,16-17H2,(H,24,25)(H,26,27) |
| InChIKey | WNLCYMMQCXLHRY-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|