C18H23O4PS — CID 57244560
2-[[hydroxy(naphthalen-1-ylsulfanylmethyl)phosphoryl]methyl]-4-methylpentanoic acid (PubChem CID 57244560) has the molecular formula C18H23O4PS and a molecular weight of 366.42 g/mol. Its IUPAC name is 2-[[hydroxy(naphthalen-1-ylsulfanylmethyl)phosphoryl]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[hydroxy(naphthalen-1-ylsulfanylmethyl)phosphoryl]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 57244560 |
| Molecular Formula | C18H23O4PS |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 2-[[hydroxy(naphthalen-1-ylsulfanylmethyl)phosphoryl]methyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(CP(=O)(O)CSc1cccc2ccccc12)C(=O)O |
| InChI | InChI=1S/C18H23O4PS/c1-13(2)10-15(18(19)20)11-23(21,22)12-24-17-9-5-7-14-6-3-4-8-16(14)17/h3-9,13,15H,10-12H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | AYSMYWPBZWJQFO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|