C12H26NO4P — CID 11087139
2-[[(1-amino-3-methylbutyl)-hydroxyphosphoryl]methyl]-4-methylpentanoic acid (PubChem CID 11087139) has the molecular formula C12H26NO4P and a molecular weight of 279.32 g/mol. Its IUPAC name is 2-[[(1-amino-3-methylbutyl)-hydroxyphosphoryl]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[(1-amino-3-methylbutyl)-hydroxyphosphoryl]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 11087139 |
| Molecular Formula | C12H26NO4P |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2-[[(1-amino-3-methylbutyl)-hydroxyphosphoryl]methyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(CP(=O)(O)C(N)CC(C)C)C(=O)O |
| InChI | InChI=1S/C12H26NO4P/c1-8(2)5-10(12(14)15)7-18(16,17)11(13)6-9(3)4/h8-11H,5-7,13H2,1-4H3,(H,14,15)(H,16,17) |
| InChIKey | GUROYFQDMNQKKP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|