C7H16NO4P — CID 3325223
2-[(1-amino-3-methylbutyl)-hydroxyphosphoryl]acetic acid (PubChem CID 3325223) has the molecular formula C7H16NO4P and a molecular weight of 209.18 g/mol. Its IUPAC name is 2-[(1-amino-3-methylbutyl)-hydroxyphosphoryl]acetic acid.
| Compound Name | 2-[(1-amino-3-methylbutyl)-hydroxyphosphoryl]acetic acid |
|---|---|
| PubChem CID | 3325223 |
| Molecular Formula | C7H16NO4P |
| Molecular Weight | 209.18 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 2-[(1-amino-3-methylbutyl)-hydroxyphosphoryl]acetic acid |
| SMILES | CC(C)CC(N)P(=O)(O)CC(=O)O |
| InChI | InChI=1S/C7H16NO4P/c1-5(2)3-6(8)13(11,12)4-7(9)10/h5-6H,3-4,8H2,1-2H3,(H,9,10)(H,11,12) |
| InChIKey | QLKPCHBADCFRHB-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.18 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|