C8H20NO6P — CID 87556068
(3S)-3-(aminomethyl)-5-methylhexanoic acid;phosphoric acid (PubChem CID 87556068) has the molecular formula C8H20NO6P and a molecular weight of 257.22 g/mol. Its IUPAC name is (3S)-3-(aminomethyl)-5-methylhexanoic acid;phosphoric acid.
| Compound Name | (3S)-3-(aminomethyl)-5-methylhexanoic acid;phosphoric acid |
|---|---|
| PubChem CID | 87556068 |
| Molecular Formula | C8H20NO6P |
| Molecular Weight | 257.22 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | (3S)-3-(aminomethyl)-5-methylhexanoic acid;phosphoric acid |
| SMILES | CC(C)C[C@H](CN)CC(=O)O.O=P(O)(O)O |
| InChI | InChI=1S/C8H17NO2.H3O4P/c1-6(2)3-7(5-9)4-8(10)11;1-5(2,3)4/h6-7H,3-5,9H2,1-2H3,(H,10,11);(H3,1,2,3,4)/t7-;/m0./s1 |
| InChIKey | PDOULPOLPRRIGX-FJXQXJEOSA-N |
| XLogP | 0.15 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.22 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|