C8H18NNaO2 — CID 173084628
sodium;(3S)-3-(aminomethyl)-5-methylhexanoic acid;hydride (PubChem CID 173084628) has the molecular formula C8H18NNaO2 and a molecular weight of 183.23 g/mol. Its IUPAC name is sodium;(3S)-3-(aminomethyl)-5-methylhexanoic acid;hydride.
| Compound Name | sodium;(3S)-3-(aminomethyl)-5-methylhexanoic acid;hydride |
|---|---|
| PubChem CID | 173084628 |
| Molecular Formula | C8H18NNaO2 |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.12 |
| IUPAC Name | sodium;(3S)-3-(aminomethyl)-5-methylhexanoic acid;hydride |
| SMILES | CC(C)CC(CN)CC(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C8H17NO2.Na.H/c1-6(2)3-7(5-9)4-8(10)11;;/h6-7H,3-5,9H2,1-2H3,(H,10,11);;/q;+1;-1 |
| InChIKey | XVOYYPVNDJNOKE-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |