C8H17NO2 — CID 4715169
3-(aminomethyl)-5-methylhexanoic acid (PubChem CID 4715169) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is 3-(aminomethyl)-5-methylhexanoic acid.
| Compound Name | 3-(aminomethyl)-5-methylhexanoic acid |
|---|---|
| PubChem CID | 4715169 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 3-(aminomethyl)-5-methylhexanoic acid |
| SMILES | CC(C)CC(CN)CC(=O)O |
| InChI | InChI=1S/C8H17NO2/c1-6(2)3-7(5-9)4-8(10)11/h6-7H,3-5,9H2,1-2H3,(H,10,11) |
| InChIKey | AYXYPKUFHZROOJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |