C8H18NO5P — CID 139090263
(2S,3R)-2-amino-5-methyl-3-(phosphonomethyl)hexanoic acid (PubChem CID 139090263) has the molecular formula C8H18NO5P and a molecular weight of 239.21 g/mol. Its IUPAC name is (2S,3R)-2-amino-5-methyl-3-(phosphonomethyl)hexanoic acid.
| Compound Name | (2S,3R)-2-amino-5-methyl-3-(phosphonomethyl)hexanoic acid |
|---|---|
| PubChem CID | 139090263 |
| Molecular Formula | C8H18NO5P |
| Molecular Weight | 239.21 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | (2S,3R)-2-amino-5-methyl-3-(phosphonomethyl)hexanoic acid |
| SMILES | CC(C)C[C@@H](CP(=O)(O)O)[C@H](N)C(=O)O |
| InChI | InChI=1S/C8H18NO5P/c1-5(2)3-6(4-15(12,13)14)7(9)8(10)11/h5-7H,3-4,9H2,1-2H3,(H,10,11)(H2,12,13,14)/t6-,7-/m0/s1 |
| InChIKey | RQOOJEXSXZTJDP-BQBZGAKWSA-N |
| XLogP | 0.24 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.21 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|