C8H19N2O4P — CID 57391510
(2R)-2-[[[(1R)-1-aminoethyl]-hydroxyphosphoryl]amino]-4-methylpentanoic acid (PubChem CID 57391510) has the molecular formula C8H19N2O4P and a molecular weight of 238.22 g/mol. Its IUPAC name is (2R)-2-[[[(1R)-1-aminoethyl]-hydroxyphosphoryl]amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[[[(1R)-1-aminoethyl]-hydroxyphosphoryl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 57391510 |
| Molecular Formula | C8H19N2O4P |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | (2R)-2-[[[(1R)-1-aminoethyl]-hydroxyphosphoryl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](NP(=O)(O)[C@H](C)N)C(=O)O |
| InChI | InChI=1S/C8H19N2O4P/c1-5(2)4-7(8(11)12)10-15(13,14)6(3)9/h5-7H,4,9H2,1-3H3,(H,11,12)(H2,10,13,14)/t6-,7-/m1/s1 |
| InChIKey | OFMYRIJQCHEXJJ-RNFRBKRXSA-N |
| XLogP | 0.57 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|