C6H13NO3 — CID 175756244
(2S)-2-(deuteriooxyamino)-4-methylpentanoic acid (PubChem CID 175756244) has the molecular formula C6H13NO3 and a molecular weight of 148.18 g/mol. Its IUPAC name is (2S)-2-(deuteriooxyamino)-4-methylpentanoic acid.
| Compound Name | (2S)-2-(deuteriooxyamino)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 175756244 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 148.18 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | (2S)-2-(deuteriooxyamino)-4-methylpentanoic acid |
| SMILES | [2H]ON[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C6H13NO3/c1-4(2)3-5(7-10)6(8)9/h4-5,7,10H,3H2,1-2H3,(H,8,9)/t5-/m0/s1/i10D |
| InChIKey | HJEXNFCNNXWHLC-ASBCWWNGSA-N |
| XLogP | 0.46 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.18 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|