C7H16ClNO2 — CID 156767748
(2S)-2-(deuteriomethylamino)-4-methylpentanoic acid;hydrochloride (PubChem CID 156767748) has the molecular formula C7H16ClNO2 and a molecular weight of 182.67 g/mol. Its IUPAC name is (2S)-2-(deuteriomethylamino)-4-methylpentanoic acid;hydrochloride.
| Compound Name | (2S)-2-(deuteriomethylamino)-4-methylpentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 156767748 |
| Molecular Formula | C7H16ClNO2 |
| Molecular Weight | 182.67 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (2S)-2-(deuteriomethylamino)-4-methylpentanoic acid;hydrochloride |
| SMILES | Cl.[2H]CN[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C7H15NO2.ClH/c1-5(2)4-6(8-3)7(9)10;/h5-6,8H,4H2,1-3H3,(H,9,10);1H/t6-;/m0./s1/i3D; |
| InChIKey | QYFWCUVWMMTENJ-QYARCOGASA-N |
| XLogP | 1.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.67 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |