C14H30N2O5 — CID 87981029
(2S)-2-[hydroxy(methyl)amino]-4-methylpentanoic acid;(2S)-4-methyl-2-(methylamino)pentanoic acid (PubChem CID 87981029) has the molecular formula C14H30N2O5 and a molecular weight of 306.40 g/mol. Its IUPAC name is (2S)-2-[hydroxy(methyl)amino]-4-methylpentanoic acid;(2S)-4-methyl-2-(methylamino)pentanoic acid.
| Compound Name | (2S)-2-[hydroxy(methyl)amino]-4-methylpentanoic acid;(2S)-4-methyl-2-(methylamino)pentanoic acid |
|---|---|
| PubChem CID | 87981029 |
| Molecular Formula | C14H30N2O5 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (2S)-2-[hydroxy(methyl)amino]-4-methylpentanoic acid;(2S)-4-methyl-2-(methylamino)pentanoic acid |
| SMILES | CC(C)C[C@@H](C(=O)O)N(C)O.CN[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C7H15NO3.C7H15NO2/c1-5(2)4-6(7(9)10)8(3)11;1-5(2)4-6(8-3)7(9)10/h5-6,11H,4H2,1-3H3,(H,9,10);5-6,8H,4H2,1-3H3,(H,9,10)/t2*6-/m00/s1 |
| InChIKey | FHYXLYJNBUEVRA-HKGPVOKGSA-N |
| XLogP | 1.51 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|