C9H21N3O — CID 50994387
(2S)-N,N',4-trimethyl-2-(methylamino)pentanehydrazide (PubChem CID 50994387) has the molecular formula C9H21N3O and a molecular weight of 187.29 g/mol. Its IUPAC name is (2S)-N,N',4-trimethyl-2-(methylamino)pentanehydrazide.
| Compound Name | (2S)-N,N',4-trimethyl-2-(methylamino)pentanehydrazide |
|---|---|
| PubChem CID | 50994387 |
| Molecular Formula | C9H21N3O |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | (2S)-N,N',4-trimethyl-2-(methylamino)pentanehydrazide |
| SMILES | CN[C@@H](CC(C)C)C(=O)N(C)NC |
| InChI | InChI=1S/C9H21N3O/c1-7(2)6-8(10-3)9(13)12(5)11-4/h7-8,10-11H,6H2,1-5H3/t8-/m0/s1 |
| InChIKey | RNFGFPVBVNJMKA-QMMMGPOBSA-N |
| XLogP | 0.21 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|