About (2S)-N,N',4-trimethyl-2-(methylamino)pentanehydrazide
(2S)-N,N',4-trimethyl-2-(methylamino)pentanehydrazide (PubChem CID 50994387) has the molecular formula C9H21N3O
and a molecular weight of 187.29 g/mol. Its IUPAC name is (2S)-N,N',4-trimethyl-2-(methylamino)pentanehydrazide.
Molecular Properties
| Compound Name | (2S)-N,N',4-trimethyl-2-(methylamino)pentanehydrazide |
| PubChem CID | 50994387 |
| Molecular Formula | C9H21N3O |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | (2S)-N,N',4-trimethyl-2-(methylamino)pentanehydrazide |
| SMILES | CN[C@@H](CC(C)C)C(=O)N(C)NC |
| InChI | InChI=1S/C9H21N3O/c1-7(2)6-8(10-3)9(13)12(5)11-4/h7-8,10-11H,6H2,1-5H3/t8-/m0/s1 |
| InChIKey | RNFGFPVBVNJMKA-QMMMGPOBSA-N |
| XLogP | 0.21 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N,N',4-trimethyl-2-(methylamino)pentanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N,N',4-trimethyl-2-(methylamino)pentanehydrazide?
The IUPAC name of (2S)-N,N',4-trimethyl-2-(methylamino)pentanehydrazide (CID 50994387) is (2S)-N,N',4-trimethyl-2-(methylamino)pentanehydrazide.
What is the SMILES notation for (2S)-N,N',4-trimethyl-2-(methylamino)pentanehydrazide?
The canonical SMILES for (2S)-N,N',4-trimethyl-2-(methylamino)pentanehydrazide is CN[C@@H](CC(C)C)C(=O)N(C)NC.
What is the InChIKey of (2S)-N,N',4-trimethyl-2-(methylamino)pentanehydrazide?
The InChIKey is RNFGFPVBVNJMKA-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H21N3O/c1-7(2)6-8(10-3)9(13)12(5)11-4/h7-8,10-11H,6H2,1-5H3/t8-/m0/s1.
What are the key properties of (2S)-N,N',4-trimethyl-2-(methylamino)pentanehydrazide?
(2S)-N,N',4-trimethyl-2-(methylamino)pentanehydrazide has a molecular weight of 187.29 g/mol, XLogP of 0.21, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N,N',4-trimethyl-2-(methylamino)pentanehydrazide is sourced from PubChem (CID 50994387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).