C16H23BrF3N3O — CID 170695231
2-[[1-(4-bromophenyl)-2,2,2-trifluoroethyl]amino]-N,N',4-trimethylpentanehydrazide (PubChem CID 170695231) has the molecular formula C16H23BrF3N3O and a molecular weight of 410.28 g/mol. Its IUPAC name is 2-[[1-(4-bromophenyl)-2,2,2-trifluoroethyl]amino]-N,N',4-trimethylpentanehydrazide.
| Compound Name | 2-[[1-(4-bromophenyl)-2,2,2-trifluoroethyl]amino]-N,N',4-trimethylpentanehydrazide |
|---|---|
| PubChem CID | 170695231 |
| Molecular Formula | C16H23BrF3N3O |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 2-[[1-(4-bromophenyl)-2,2,2-trifluoroethyl]amino]-N,N',4-trimethylpentanehydrazide |
| SMILES | CNN(C)C(=O)C(CC(C)C)NC(c1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C16H23BrF3N3O/c1-10(2)9-13(15(24)23(4)21-3)22-14(16(18,19)20)11-5-7-12(17)8-6-11/h5-8,10,13-14,21-22H,9H2,1-4H3 |
| InChIKey | OTOKEOIOEUHCGB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|