C10H11BrF3N — CID 43488624
1-(4-bromophenyl)-N-ethyl-2,2,2-trifluoroethanamine (PubChem CID 43488624) has the molecular formula C10H11BrF3N and a molecular weight of 282.10 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-ethyl-2,2,2-trifluoroethanamine.
| Compound Name | 1-(4-bromophenyl)-N-ethyl-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 43488624 |
| Molecular Formula | C10H11BrF3N |
| Molecular Weight | 282.10 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 1-(4-bromophenyl)-N-ethyl-2,2,2-trifluoroethanamine |
| SMILES | CCNC(c1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C10H11BrF3N/c1-2-15-9(10(12,13)14)7-3-5-8(11)6-4-7/h3-6,9,15H,2H2,1H3 |
| InChIKey | WQPYXANMRZNCHX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.10 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |