C13H20BrN — CID 43488631
1-(4-bromophenyl)-N-ethyl-2,2-dimethylpropan-1-amine (PubChem CID 43488631) has the molecular formula C13H20BrN and a molecular weight of 270.21 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-ethyl-2,2-dimethylpropan-1-amine.
| Compound Name | 1-(4-bromophenyl)-N-ethyl-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 43488631 |
| Molecular Formula | C13H20BrN |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 1-(4-bromophenyl)-N-ethyl-2,2-dimethylpropan-1-amine |
| SMILES | CCNC(c1ccc(Br)cc1)C(C)(C)C |
| InChI | InChI=1S/C13H20BrN/c1-5-15-12(13(2,3)4)10-6-8-11(14)9-7-10/h6-9,12,15H,5H2,1-4H3 |
| InChIKey | GKBQTAFWCFXANB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |