C13H21NO3S — CID 139351120
4-[1-(ethylamino)-2,2-dimethylpropyl]benzenesulfonic acid (PubChem CID 139351120) has the molecular formula C13H21NO3S and a molecular weight of 271.38 g/mol. Its IUPAC name is 4-[1-(ethylamino)-2,2-dimethylpropyl]benzenesulfonic acid.
| Compound Name | 4-[1-(ethylamino)-2,2-dimethylpropyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 139351120 |
| Molecular Formula | C13H21NO3S |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 4-[1-(ethylamino)-2,2-dimethylpropyl]benzenesulfonic acid |
| SMILES | CCNC(c1ccc(S(=O)(=O)O)cc1)C(C)(C)C |
| InChI | InChI=1S/C13H21NO3S/c1-5-14-12(13(2,3)4)10-6-8-11(9-7-10)18(15,16)17/h6-9,12,14H,5H2,1-4H3,(H,15,16,17) |
| InChIKey | ANNKWWFYSDNUGL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|