C18H18BrF6N3O — CID 87345222
(2S,4S)-2-[[(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]amino]-N-(1-cyanocyclopropyl)-5,5,5-trifluoro-4-methylpentanamide (PubChem CID 87345222) has the molecular formula C18H18BrF6N3O and a molecular weight of 486.25 g/mol. Its IUPAC name is (2S,4S)-2-[[(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]amino]-N-(1-cyanocyclopropyl)-5,5,5-trifluoro-4-methylpentanamide.
| Compound Name | (2S,4S)-2-[[(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]amino]-N-(1-cyanocyclopropyl)-5,5,5-trifluoro-4-methylpentanamide |
|---|---|
| PubChem CID | 87345222 |
| Molecular Formula | C18H18BrF6N3O |
| Molecular Weight | 486.25 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | (2S,4S)-2-[[(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]amino]-N-(1-cyanocyclopropyl)-5,5,5-trifluoro-4-methylpentanamide |
| SMILES | C[C@@H](C[C@H](N[C@@H](c1ccc(Br)cc1)C(F)(F)F)C(=O)NC1(C#N)CC1)C(F)(F)F |
| InChI | InChI=1S/C18H18BrF6N3O/c1-10(17(20,21)22)8-13(15(29)28-16(9-26)6-7-16)27-14(18(23,24)25)11-2-4-12(19)5-3-11/h2-5,10,13-14,27H,6-8H2,1H3,(H,28,29)/t10-,13-,14-/m0/s1 |
| InChIKey | QKVVXZCYXDQLKN-BPNCWPANSA-N |
| XLogP | 4.77 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.25 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |