C16H17F3N4O5S — CID 177381656
(2R)-N-(1-cyanocyclopropyl)-3-methylsulfonyl-2-[[(1S)-2,2,2-trifluoro-1-(4-nitrophenyl)ethyl]amino]propanamide (PubChem CID 177381656) has the molecular formula C16H17F3N4O5S and a molecular weight of 434.40 g/mol. Its IUPAC name is (2R)-N-(1-cyanocyclopropyl)-3-methylsulfonyl-2-[[(1S)-2,2,2-trifluoro-1-(4-nitrophenyl)ethyl]amino]propanamide.
| Compound Name | (2R)-N-(1-cyanocyclopropyl)-3-methylsulfonyl-2-[[(1S)-2,2,2-trifluoro-1-(4-nitrophenyl)ethyl]amino]propanamide |
|---|---|
| PubChem CID | 177381656 |
| Molecular Formula | C16H17F3N4O5S |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | (2R)-N-(1-cyanocyclopropyl)-3-methylsulfonyl-2-[[(1S)-2,2,2-trifluoro-1-(4-nitrophenyl)ethyl]amino]propanamide |
| SMILES | CS(=O)(=O)C[C@H](N[C@@H](c1ccc([N+](=O)[O-])cc1)C(F)(F)F)C(=O)NC1(C#N)CC1 |
| InChI | InChI=1S/C16H17F3N4O5S/c1-29(27,28)8-12(14(24)22-15(9-20)6-7-15)21-13(16(17,18)19)10-2-4-11(5-3-10)23(25)26/h2-5,12-13,21H,6-8H2,1H3,(H,22,24)/t12-,13-/m0/s1 |
| InChIKey | WEABYIRGFHCTJN-STQMWFEESA-N |
| XLogP | 1.37 |
| TPSA | 142.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|