C12H11BrCl2F3NO2 — CID 152601846
2-[[(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]amino]-4,4-dichlorobutanoic acid (PubChem CID 152601846) has the molecular formula C12H11BrCl2F3NO2 and a molecular weight of 409.03 g/mol. Its IUPAC name is 2-[[(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]amino]-4,4-dichlorobutanoic acid.
| Compound Name | 2-[[(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]amino]-4,4-dichlorobutanoic acid |
|---|---|
| PubChem CID | 152601846 |
| Molecular Formula | C12H11BrCl2F3NO2 |
| Molecular Weight | 409.03 g/mol |
| Exact Mass | 406.93 |
| IUPAC Name | 2-[[(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]amino]-4,4-dichlorobutanoic acid |
| SMILES | O=C(O)C(CC(Cl)Cl)N[C@@H](c1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C12H11BrCl2F3NO2/c13-7-3-1-6(2-4-7)10(12(16,17)18)19-8(11(20)21)5-9(14)15/h1-4,8-10,19H,5H2,(H,20,21)/t8?,10-/m0/s1 |
| InChIKey | YXRURMWUBGVPQK-HTLJXXAVSA-N |
| XLogP | 4.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.03 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|