C12H9BrCl2F3NO2 — CID 59603043
(2S)-2-[[1-(4-bromophenyl)-2,2,2-trifluoroethylidene]amino]-4,4-dichlorobutanoic acid (PubChem CID 59603043) has the molecular formula C12H9BrCl2F3NO2 and a molecular weight of 407.01 g/mol. Its IUPAC name is (2S)-2-[[1-(4-bromophenyl)-2,2,2-trifluoroethylidene]amino]-4,4-dichlorobutanoic acid.
| Compound Name | (2S)-2-[[1-(4-bromophenyl)-2,2,2-trifluoroethylidene]amino]-4,4-dichlorobutanoic acid |
|---|---|
| PubChem CID | 59603043 |
| Molecular Formula | C12H9BrCl2F3NO2 |
| Molecular Weight | 407.01 g/mol |
| Exact Mass | 404.91 |
| IUPAC Name | (2S)-2-[[1-(4-bromophenyl)-2,2,2-trifluoroethylidene]amino]-4,4-dichlorobutanoic acid |
| SMILES | O=C(O)[C@H](CC(Cl)Cl)/N=C(\c1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C12H9BrCl2F3NO2/c13-7-3-1-6(2-4-7)10(12(16,17)18)19-8(11(20)21)5-9(14)15/h1-4,8-9H,5H2,(H,20,21)/b19-10+/t8-/m0/s1 |
| InChIKey | OCSODWNBORACBF-IQWKJTCMSA-N |
| XLogP | 4.45 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.01 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|