C9H6BrCl2NO — CID 175564438
4-bromo-N-(2,2-dichloroethylidene)benzamide (PubChem CID 175564438) has the molecular formula C9H6BrCl2NO and a molecular weight of 294.96 g/mol. Its IUPAC name is 4-bromo-N-(2,2-dichloroethylidene)benzamide.
| Compound Name | 4-bromo-N-(2,2-dichloroethylidene)benzamide |
|---|---|
| PubChem CID | 175564438 |
| Molecular Formula | C9H6BrCl2NO |
| Molecular Weight | 294.96 g/mol |
| Exact Mass | 292.90 |
| IUPAC Name | 4-bromo-N-(2,2-dichloroethylidene)benzamide |
| SMILES | O=C(/N=C/C(Cl)Cl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C9H6BrCl2NO/c10-7-3-1-6(2-4-7)9(14)13-5-8(11)12/h1-5,8H/b13-5+ |
| InChIKey | ZYCUUUMRFWWOIR-WLRTZDKTSA-N |
| XLogP | 3.46 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.96 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|