C11H10BrF3O2 — CID 79418227
2-[(4-bromophenyl)methyl]-4,4,4-trifluorobutanoic acid (PubChem CID 79418227) has the molecular formula C11H10BrF3O2 and a molecular weight of 311.10 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-4,4,4-trifluorobutanoic acid.
| Compound Name | 2-[(4-bromophenyl)methyl]-4,4,4-trifluorobutanoic acid |
|---|---|
| PubChem CID | 79418227 |
| Molecular Formula | C11H10BrF3O2 |
| Molecular Weight | 311.10 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-4,4,4-trifluorobutanoic acid |
| SMILES | O=C(O)C(Cc1ccc(Br)cc1)CC(F)(F)F |
| InChI | InChI=1S/C11H10BrF3O2/c12-9-3-1-7(2-4-9)5-8(10(16)17)6-11(13,14)15/h1-4,8H,5-6H2,(H,16,17) |
| InChIKey | KUHARDFDTKFEPP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.10 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |