C10H11BrO2S — CID 15673442
2-[(4-bromophenyl)methyl]-3-sulfanylpropanoic acid (PubChem CID 15673442) has the molecular formula C10H11BrO2S and a molecular weight of 275.17 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-3-sulfanylpropanoic acid.
| Compound Name | 2-[(4-bromophenyl)methyl]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 15673442 |
| Molecular Formula | C10H11BrO2S |
| Molecular Weight | 275.17 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-3-sulfanylpropanoic acid |
| SMILES | O=C(O)C(CS)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C10H11BrO2S/c11-9-3-1-7(2-4-9)5-8(6-14)10(12)13/h1-4,8,14H,5-6H2,(H,12,13) |
| InChIKey | LWBUUWLWBDNPMB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.17 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|