C21H21F4NO4S — CID 89379434
(2S)-4-fluoro-4-methyl-2-[[2,2,2-trifluoro-1-[4-(4-methylsulfonylphenyl)phenyl]ethylidene]amino]pentanoic acid (PubChem CID 89379434) has the molecular formula C21H21F4NO4S and a molecular weight of 459.46 g/mol. Its IUPAC name is (2S)-4-fluoro-4-methyl-2-[[2,2,2-trifluoro-1-[4-(4-methylsulfonylphenyl)phenyl]ethylidene]amino]pentanoic acid.
| Compound Name | (2S)-4-fluoro-4-methyl-2-[[2,2,2-trifluoro-1-[4-(4-methylsulfonylphenyl)phenyl]ethylidene]amino]pentanoic acid |
|---|---|
| PubChem CID | 89379434 |
| Molecular Formula | C21H21F4NO4S |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | (2S)-4-fluoro-4-methyl-2-[[2,2,2-trifluoro-1-[4-(4-methylsulfonylphenyl)phenyl]ethylidene]amino]pentanoic acid |
| SMILES | CC(C)(F)C[C@H](/N=C(\c1ccc(-c2ccc(S(C)(=O)=O)cc2)cc1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C21H21F4NO4S/c1-20(2,22)12-17(19(27)28)26-18(21(23,24)25)15-6-4-13(5-7-15)14-8-10-16(11-9-14)31(3,29)30/h4-11,17H,12H2,1-3H3,(H,27,28)/b26-18+/t17-/m0/s1 |
| InChIKey | FJMZMQBDHPKAPG-DXMZOVICSA-N |
| XLogP | 4.70 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|