2-[[(1S)-2,2,2-trifluoro-1-phenylethyl]amino]butanoic acid

C12H14F3NO2 — CID 122592350

IUPAC2-[[(1S)-2,2,2-trifluoro-1-phenylethyl]amino]butanoic acid
SMILESCCC(N[C@@H](c1ccccc1)C(F)(F)F)C(=O)O
InChIInChI=1S/C12H14F3NO2/c1-2-9(11(17)18)16-10(12(13,14)15)8-6-4-3-5-7-8/h3-7,9-10,16H,2H2,1H3,(H,17,18)/t9?,10-/m0/s1
InChIKeyQBBVNRAHPIDAJJ-AXDSSHIGSA-N
MW261.24 g/mol
LogP2.74
Rot. Bonds5

About 2-[[(1S)-2,2,2-trifluoro-1-phenylethyl]amino]butanoic acid

2-[[(1S)-2,2,2-trifluoro-1-phenylethyl]amino]butanoic acid (PubChem CID 122592350) has the molecular formula C12H14F3NO2 and a molecular weight of 261.24 g/mol. Its IUPAC name is 2-[[(1S)-2,2,2-trifluoro-1-phenylethyl]amino]butanoic acid.

Molecular Properties

Compound Name2-[[(1S)-2,2,2-trifluoro-1-phenylethyl]amino]butanoic acid
PubChem CID122592350
Molecular FormulaC12H14F3NO2
Molecular Weight261.24 g/mol
Exact Mass261.10
IUPAC Name2-[[(1S)-2,2,2-trifluoro-1-phenylethyl]amino]butanoic acid
SMILESCCC(N[C@@H](c1ccccc1)C(F)(F)F)C(=O)O
InChIInChI=1S/C12H14F3NO2/c1-2-9(11(17)18)16-10(12(13,14)15)8-6-4-3-5-7-8/h3-7,9-10,16H,2H2,1H3,(H,17,18)/t9?,10-/m0/s1
InChIKeyQBBVNRAHPIDAJJ-AXDSSHIGSA-N
XLogP2.74
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.24
LogP ≤ 52.74
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[[(1S)-2,2,2-trifluoro-1-phenylethyl]amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[(1S)-2,2,2-trifluoro-1-phenylethyl]amino]butanoic acid?
The IUPAC name of 2-[[(1S)-2,2,2-trifluoro-1-phenylethyl]amino]butanoic acid (CID 122592350) is 2-[[(1S)-2,2,2-trifluoro-1-phenylethyl]amino]butanoic acid.
What is the SMILES notation for 2-[[(1S)-2,2,2-trifluoro-1-phenylethyl]amino]butanoic acid?
The canonical SMILES for 2-[[(1S)-2,2,2-trifluoro-1-phenylethyl]amino]butanoic acid is CCC(N[C@@H](c1ccccc1)C(F)(F)F)C(=O)O.
What is the InChIKey of 2-[[(1S)-2,2,2-trifluoro-1-phenylethyl]amino]butanoic acid?
The InChIKey is QBBVNRAHPIDAJJ-AXDSSHIGSA-N. The full InChI is InChI=1S/C12H14F3NO2/c1-2-9(11(17)18)16-10(12(13,14)15)8-6-4-3-5-7-8/h3-7,9-10,16H,2H2,1H3,(H,17,18)/t9?,10-/m0/s1.
What are the key properties of 2-[[(1S)-2,2,2-trifluoro-1-phenylethyl]amino]butanoic acid?
2-[[(1S)-2,2,2-trifluoro-1-phenylethyl]amino]butanoic acid has a molecular weight of 261.24 g/mol, XLogP of 2.74, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(1S)-2,2,2-trifluoro-1-phenylethyl]amino]butanoic acid is sourced from PubChem (CID 122592350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).