C15H22F3N3O — CID 70317414
(2S)-N-(aminomethyl)-4-methyl-2-[(2,2,2-trifluoro-1-phenylethyl)amino]pentanamide (PubChem CID 70317414) has the molecular formula C15H22F3N3O and a molecular weight of 317.36 g/mol. Its IUPAC name is (2S)-N-(aminomethyl)-4-methyl-2-[(2,2,2-trifluoro-1-phenylethyl)amino]pentanamide.
| Compound Name | (2S)-N-(aminomethyl)-4-methyl-2-[(2,2,2-trifluoro-1-phenylethyl)amino]pentanamide |
|---|---|
| PubChem CID | 70317414 |
| Molecular Formula | C15H22F3N3O |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | (2S)-N-(aminomethyl)-4-methyl-2-[(2,2,2-trifluoro-1-phenylethyl)amino]pentanamide |
| SMILES | CC(C)C[C@H](NC(c1ccccc1)C(F)(F)F)C(=O)NCN |
| InChI | InChI=1S/C15H22F3N3O/c1-10(2)8-12(14(22)20-9-19)21-13(15(16,17)18)11-6-4-3-5-7-11/h3-7,10,12-13,21H,8-9,19H2,1-2H3,(H,20,22)/t12-,13?/m0/s1 |
| InChIKey | JENXEHVILCKZFF-UEWDXFNNSA-N |
| XLogP | 2.33 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|