C24H26F3N3O3 — CID 87345858
methyl 4-[4-[1-[[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]amino]-2,2,2-trifluoroethyl]phenyl]benzoate (PubChem CID 87345858) has the molecular formula C24H26F3N3O3 and a molecular weight of 461.48 g/mol. Its IUPAC name is methyl 4-[4-[1-[[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]amino]-2,2,2-trifluoroethyl]phenyl]benzoate.
| Compound Name | methyl 4-[4-[1-[[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]amino]-2,2,2-trifluoroethyl]phenyl]benzoate |
|---|---|
| PubChem CID | 87345858 |
| Molecular Formula | C24H26F3N3O3 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | methyl 4-[4-[1-[[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]amino]-2,2,2-trifluoroethyl]phenyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(C(NC(CC(C)C)C(=O)NCC#N)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H26F3N3O3/c1-15(2)14-20(22(31)29-13-12-28)30-21(24(25,26)27)18-8-4-16(5-9-18)17-6-10-19(11-7-17)23(32)33-3/h4-11,15,20-21,30H,13-14H2,1-3H3,(H,29,31) |
| InChIKey | AURYJBBJORKCEH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|