C23H24F3N3O2 — CID 23648305
(2S)-2-[[(1S)-1-(4-benzoylphenyl)-2,2,2-trifluoroethyl]amino]-N-(cyanomethyl)-4-methylpentanamide (PubChem CID 23648305) has the molecular formula C23H24F3N3O2 and a molecular weight of 431.46 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-(4-benzoylphenyl)-2,2,2-trifluoroethyl]amino]-N-(cyanomethyl)-4-methylpentanamide.
| Compound Name | (2S)-2-[[(1S)-1-(4-benzoylphenyl)-2,2,2-trifluoroethyl]amino]-N-(cyanomethyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 23648305 |
| Molecular Formula | C23H24F3N3O2 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | (2S)-2-[[(1S)-1-(4-benzoylphenyl)-2,2,2-trifluoroethyl]amino]-N-(cyanomethyl)-4-methylpentanamide |
| SMILES | CC(C)C[C@H](N[C@@H](c1ccc(C(=O)c2ccccc2)cc1)C(F)(F)F)C(=O)NCC#N |
| InChI | InChI=1S/C23H24F3N3O2/c1-15(2)14-19(22(31)28-13-12-27)29-21(23(24,25)26)18-10-8-17(9-11-18)20(30)16-6-4-3-5-7-16/h3-11,15,19,21,29H,13-14H2,1-2H3,(H,28,31)/t19-,21-/m0/s1 |
| InChIKey | YNFROJBIFZUSFU-FPOVZHCZSA-N |
| XLogP | 4.17 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|