C22H25F3N4O — CID 91468614
N-(cyanomethyl)-4-methyl-2-[[(1S)-2,2,2-trifluoro-1-[4-(6-methyl-3-pyridinyl)phenyl]ethyl]amino]pentanamide (PubChem CID 91468614) has the molecular formula C22H25F3N4O and a molecular weight of 418.46 g/mol. Its IUPAC name is N-(cyanomethyl)-4-methyl-2-[[(1S)-2,2,2-trifluoro-1-[4-(6-methyl-3-pyridinyl)phenyl]ethyl]amino]pentanamide.
| Compound Name | N-(cyanomethyl)-4-methyl-2-[[(1S)-2,2,2-trifluoro-1-[4-(6-methyl-3-pyridinyl)phenyl]ethyl]amino]pentanamide |
|---|---|
| PubChem CID | 91468614 |
| Molecular Formula | C22H25F3N4O |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N-(cyanomethyl)-4-methyl-2-[[(1S)-2,2,2-trifluoro-1-[4-(6-methyl-3-pyridinyl)phenyl]ethyl]amino]pentanamide |
| SMILES | Cc1ccc(-c2ccc([C@H](NC(CC(C)C)C(=O)NCC#N)C(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C22H25F3N4O/c1-14(2)12-19(21(30)27-11-10-26)29-20(22(23,24)25)17-8-6-16(7-9-17)18-5-4-15(3)28-13-18/h4-9,13-14,19-20,29H,11-12H2,1-3H3,(H,27,30)/t19?,20-/m0/s1 |
| InChIKey | QPGYZXLFKZLFGI-ANYOKISRSA-N |
| XLogP | 4.30 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|