C24H28F3N3O3S — CID 87345511
(2S)-N-(cyanomethyl)-2-[[(1S)-1-[4-(4-ethylsulfonylphenyl)phenyl]-2,2,2-trifluoroethyl]amino]-4-methylpentanamide (PubChem CID 87345511) has the molecular formula C24H28F3N3O3S and a molecular weight of 495.57 g/mol. Its IUPAC name is (2S)-N-(cyanomethyl)-2-[[(1S)-1-[4-(4-ethylsulfonylphenyl)phenyl]-2,2,2-trifluoroethyl]amino]-4-methylpentanamide.
| Compound Name | (2S)-N-(cyanomethyl)-2-[[(1S)-1-[4-(4-ethylsulfonylphenyl)phenyl]-2,2,2-trifluoroethyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 87345511 |
| Molecular Formula | C24H28F3N3O3S |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | (2S)-N-(cyanomethyl)-2-[[(1S)-1-[4-(4-ethylsulfonylphenyl)phenyl]-2,2,2-trifluoroethyl]amino]-4-methylpentanamide |
| SMILES | CCS(=O)(=O)c1ccc(-c2ccc([C@H](N[C@@H](CC(C)C)C(=O)NCC#N)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H28F3N3O3S/c1-4-34(32,33)20-11-9-18(10-12-20)17-5-7-19(8-6-17)22(24(25,26)27)30-21(15-16(2)3)23(31)29-14-13-28/h5-12,16,21-22,30H,4,14-15H2,1-3H3,(H,29,31)/t21-,22-/m0/s1 |
| InChIKey | GCHWSTNKPIJEQM-VXKWHMMOSA-N |
| XLogP | 4.39 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|