C22H24F3N3O3S — CID 87345303
(2S)-N-(cyanomethyl)-2-[[(1R)-2,2,2-trifluoro-1-[4-(4-methylsulfonylphenyl)phenyl]ethyl]amino]pentanamide (PubChem CID 87345303) has the molecular formula C22H24F3N3O3S and a molecular weight of 467.51 g/mol. Its IUPAC name is (2S)-N-(cyanomethyl)-2-[[(1R)-2,2,2-trifluoro-1-[4-(4-methylsulfonylphenyl)phenyl]ethyl]amino]pentanamide.
| Compound Name | (2S)-N-(cyanomethyl)-2-[[(1R)-2,2,2-trifluoro-1-[4-(4-methylsulfonylphenyl)phenyl]ethyl]amino]pentanamide |
|---|---|
| PubChem CID | 87345303 |
| Molecular Formula | C22H24F3N3O3S |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | (2S)-N-(cyanomethyl)-2-[[(1R)-2,2,2-trifluoro-1-[4-(4-methylsulfonylphenyl)phenyl]ethyl]amino]pentanamide |
| SMILES | CCC[C@H](N[C@H](c1ccc(-c2ccc(S(C)(=O)=O)cc2)cc1)C(F)(F)F)C(=O)NCC#N |
| InChI | InChI=1S/C22H24F3N3O3S/c1-3-4-19(21(29)27-14-13-26)28-20(22(23,24)25)17-7-5-15(6-8-17)16-9-11-18(12-10-16)32(2,30)31/h5-12,19-20,28H,3-4,14H2,1-2H3,(H,27,29)/t19-,20+/m0/s1 |
| InChIKey | DBMPITBTAXLHCJ-VQTJNVASSA-N |
| XLogP | 3.76 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|