C28H30FN3O3S — CID 59715505
(2S)-N-(cyanomethyl)-2-[[(S)-(4-fluorophenyl)-[4-(4-methylsulfonylphenyl)phenyl]methyl]amino]-4-methylpentanamide (PubChem CID 59715505) has the molecular formula C28H30FN3O3S and a molecular weight of 507.63 g/mol. Its IUPAC name is (2S)-N-(cyanomethyl)-2-[[(S)-(4-fluorophenyl)-[4-(4-methylsulfonylphenyl)phenyl]methyl]amino]-4-methylpentanamide.
| Compound Name | (2S)-N-(cyanomethyl)-2-[[(S)-(4-fluorophenyl)-[4-(4-methylsulfonylphenyl)phenyl]methyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 59715505 |
| Molecular Formula | C28H30FN3O3S |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | (2S)-N-(cyanomethyl)-2-[[(S)-(4-fluorophenyl)-[4-(4-methylsulfonylphenyl)phenyl]methyl]amino]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](N[C@H](c1ccc(F)cc1)c1ccc(-c2ccc(S(C)(=O)=O)cc2)cc1)C(=O)NCC#N |
| InChI | InChI=1S/C28H30FN3O3S/c1-19(2)18-26(28(33)31-17-16-30)32-27(23-8-12-24(29)13-9-23)22-6-4-20(5-7-22)21-10-14-25(15-11-21)36(3,34)35/h4-15,19,26-27,32H,17-18H2,1-3H3,(H,31,33)/t26-,27-/m0/s1 |
| InChIKey | PFMQMFQIVYJLGD-SVBPBHIXSA-N |
| XLogP | 4.63 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|