C21H22BrF2N3O — CID 86590551
(2S)-2-[[(S)-(4-bromophenyl)-(2,4-difluorophenyl)methyl]amino]-N-(cyanomethyl)-4-methylpentanamide (PubChem CID 86590551) has the molecular formula C21H22BrF2N3O and a molecular weight of 450.33 g/mol. Its IUPAC name is (2S)-2-[[(S)-(4-bromophenyl)-(2,4-difluorophenyl)methyl]amino]-N-(cyanomethyl)-4-methylpentanamide.
| Compound Name | (2S)-2-[[(S)-(4-bromophenyl)-(2,4-difluorophenyl)methyl]amino]-N-(cyanomethyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 86590551 |
| Molecular Formula | C21H22BrF2N3O |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | (2S)-2-[[(S)-(4-bromophenyl)-(2,4-difluorophenyl)methyl]amino]-N-(cyanomethyl)-4-methylpentanamide |
| SMILES | CC(C)C[C@H](N[C@@H](c1ccc(Br)cc1)c1ccc(F)cc1F)C(=O)NCC#N |
| InChI | InChI=1S/C21H22BrF2N3O/c1-13(2)11-19(21(28)26-10-9-25)27-20(14-3-5-15(22)6-4-14)17-8-7-16(23)12-18(17)24/h3-8,12-13,19-20,27H,10-11H2,1-2H3,(H,26,28)/t19-,20-/m0/s1 |
| InChIKey | VFUQQQHEMVGSHM-PMACEKPBSA-N |
| XLogP | 4.46 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|