C18H21BrN4OS — CID 59715490
(2S)-2-[[(S)-(4-bromophenyl)-(1,3-thiazol-2-yl)methyl]amino]-N-(cyanomethyl)-4-methylpentanamide (PubChem CID 59715490) has the molecular formula C18H21BrN4OS and a molecular weight of 421.36 g/mol. Its IUPAC name is (2S)-2-[[(S)-(4-bromophenyl)-(1,3-thiazol-2-yl)methyl]amino]-N-(cyanomethyl)-4-methylpentanamide.
| Compound Name | (2S)-2-[[(S)-(4-bromophenyl)-(1,3-thiazol-2-yl)methyl]amino]-N-(cyanomethyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 59715490 |
| Molecular Formula | C18H21BrN4OS |
| Molecular Weight | 421.36 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | (2S)-2-[[(S)-(4-bromophenyl)-(1,3-thiazol-2-yl)methyl]amino]-N-(cyanomethyl)-4-methylpentanamide |
| SMILES | CC(C)C[C@H](N[C@@H](c1ccc(Br)cc1)c1nccs1)C(=O)NCC#N |
| InChI | InChI=1S/C18H21BrN4OS/c1-12(2)11-15(17(24)21-8-7-20)23-16(18-22-9-10-25-18)13-3-5-14(19)6-4-13/h3-6,9-10,12,15-16,23H,8,11H2,1-2H3,(H,21,24)/t15-,16-/m0/s1 |
| InChIKey | ATYXZINOMANKJC-HOTGVXAUSA-N |
| XLogP | 3.64 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|