C25H34BN3O3S — CID 87345850
(2S)-N-(cyanomethyl)-4-methyl-2-[[(S)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-thiophen-2-ylmethyl]amino]pentanamide (PubChem CID 87345850) has the molecular formula C25H34BN3O3S and a molecular weight of 467.44 g/mol. Its IUPAC name is (2S)-N-(cyanomethyl)-4-methyl-2-[[(S)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-thiophen-2-ylmethyl]amino]pentanamide.
| Compound Name | (2S)-N-(cyanomethyl)-4-methyl-2-[[(S)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-thiophen-2-ylmethyl]amino]pentanamide |
|---|---|
| PubChem CID | 87345850 |
| Molecular Formula | C25H34BN3O3S |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | (2S)-N-(cyanomethyl)-4-methyl-2-[[(S)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-thiophen-2-ylmethyl]amino]pentanamide |
| SMILES | CC(C)C[C@H](N[C@@H](c1ccc(B2OC(C)(C)C(C)(C)O2)cc1)c1cccs1)C(=O)NCC#N |
| InChI | InChI=1S/C25H34BN3O3S/c1-17(2)16-20(23(30)28-14-13-27)29-22(21-8-7-15-33-21)18-9-11-19(12-10-18)26-31-24(3,4)25(5,6)32-26/h7-12,15,17,20,22,29H,14,16H2,1-6H3,(H,28,30)/t20-,22-/m0/s1 |
| InChIKey | HWJOKJGPLDQDNH-UNMCSNQZSA-N |
| XLogP | 3.78 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|