C13H22N2OS — CID 43750667
N,4-dimethyl-2-(1-thiophen-2-ylethylamino)pentanamide (PubChem CID 43750667) has the molecular formula C13H22N2OS and a molecular weight of 254.40 g/mol. Its IUPAC name is N,4-dimethyl-2-(1-thiophen-2-ylethylamino)pentanamide.
| Compound Name | N,4-dimethyl-2-(1-thiophen-2-ylethylamino)pentanamide |
|---|---|
| PubChem CID | 43750667 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N,4-dimethyl-2-(1-thiophen-2-ylethylamino)pentanamide |
| SMILES | CNC(=O)C(CC(C)C)NC(C)c1cccs1 |
| InChI | InChI=1S/C13H22N2OS/c1-9(2)8-11(13(16)14-4)15-10(3)12-6-5-7-17-12/h5-7,9-11,15H,8H2,1-4H3,(H,14,16) |
| InChIKey | HKLQBZBVRQFHMH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |