C15H23FN2O2 — CID 63067468
2-[1-(4-fluoro-2-hydroxyphenyl)ethylamino]-N,4-dimethylpentanamide (PubChem CID 63067468) has the molecular formula C15H23FN2O2 and a molecular weight of 282.36 g/mol. Its IUPAC name is 2-[1-(4-fluoro-2-hydroxyphenyl)ethylamino]-N,4-dimethylpentanamide.
| Compound Name | 2-[1-(4-fluoro-2-hydroxyphenyl)ethylamino]-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 63067468 |
| Molecular Formula | C15H23FN2O2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 2-[1-(4-fluoro-2-hydroxyphenyl)ethylamino]-N,4-dimethylpentanamide |
| SMILES | CNC(=O)C(CC(C)C)NC(C)c1ccc(F)cc1O |
| InChI | InChI=1S/C15H23FN2O2/c1-9(2)7-13(15(20)17-4)18-10(3)12-6-5-11(16)8-14(12)19/h5-6,8-10,13,18-19H,7H2,1-4H3,(H,17,20) |
| InChIKey | HWMIQNPSRJXLSY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|