C16H24F2N2O — CID 43675015
2-[1-(2,4-difluorophenyl)ethylamino]-N,N,4-trimethylpentanamide (PubChem CID 43675015) has the molecular formula C16H24F2N2O and a molecular weight of 298.38 g/mol. Its IUPAC name is 2-[1-(2,4-difluorophenyl)ethylamino]-N,N,4-trimethylpentanamide.
| Compound Name | 2-[1-(2,4-difluorophenyl)ethylamino]-N,N,4-trimethylpentanamide |
|---|---|
| PubChem CID | 43675015 |
| Molecular Formula | C16H24F2N2O |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 2-[1-(2,4-difluorophenyl)ethylamino]-N,N,4-trimethylpentanamide |
| SMILES | CC(C)CC(NC(C)c1ccc(F)cc1F)C(=O)N(C)C |
| InChI | InChI=1S/C16H24F2N2O/c1-10(2)8-15(16(21)20(4)5)19-11(3)13-7-6-12(17)9-14(13)18/h6-7,9-11,15,19H,8H2,1-5H3 |
| InChIKey | IHHPBKQEPYJBIN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |