C16H25ClN2O — CID 43675021
2-[1-(2-chlorophenyl)ethylamino]-N,N,4-trimethylpentanamide (PubChem CID 43675021) has the molecular formula C16H25ClN2O and a molecular weight of 296.84 g/mol. Its IUPAC name is 2-[1-(2-chlorophenyl)ethylamino]-N,N,4-trimethylpentanamide.
| Compound Name | 2-[1-(2-chlorophenyl)ethylamino]-N,N,4-trimethylpentanamide |
|---|---|
| PubChem CID | 43675021 |
| Molecular Formula | C16H25ClN2O |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2-[1-(2-chlorophenyl)ethylamino]-N,N,4-trimethylpentanamide |
| SMILES | CC(C)CC(NC(C)c1ccccc1Cl)C(=O)N(C)C |
| InChI | InChI=1S/C16H25ClN2O/c1-11(2)10-15(16(20)19(4)5)18-12(3)13-8-6-7-9-14(13)17/h6-9,11-12,15,18H,10H2,1-5H3 |
| InChIKey | ALGSBCBYTZORJN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |