C10H13ClN2O — CID 83533893
2-amino-2-(2-chlorophenyl)-N,N-dimethylacetamide (PubChem CID 83533893) has the molecular formula C10H13ClN2O and a molecular weight of 212.68 g/mol. Its IUPAC name is 2-amino-2-(2-chlorophenyl)-N,N-dimethylacetamide.
| Compound Name | 2-amino-2-(2-chlorophenyl)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 83533893 |
| Molecular Formula | C10H13ClN2O |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 2-amino-2-(2-chlorophenyl)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C(N)c1ccccc1Cl |
| InChI | InChI=1S/C10H13ClN2O/c1-13(2)10(14)9(12)7-5-3-4-6-8(7)11/h3-6,9H,12H2,1-2H3 |
| InChIKey | QXFVIXCRHSJJDY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |