C9H12Cl2N2O — CID 161139113
1,2-dichlorobenzene;1,1-dimethylurea (PubChem CID 161139113) has the molecular formula C9H12Cl2N2O and a molecular weight of 235.11 g/mol. Its IUPAC name is 1,2-dichlorobenzene;1,1-dimethylurea.
| Compound Name | 1,2-dichlorobenzene;1,1-dimethylurea |
|---|---|
| PubChem CID | 161139113 |
| Molecular Formula | C9H12Cl2N2O |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 1,2-dichlorobenzene;1,1-dimethylurea |
| SMILES | CN(C)C(N)=O.Clc1ccccc1Cl |
| InChI | InChI=1S/C6H4Cl2.C3H8N2O/c7-5-3-1-2-4-6(5)8;1-5(2)3(4)6/h1-4H;1-2H3,(H2,4,6) |
| InChIKey | UNERATQVYQOLEH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |