About 1,2-dichlorobenzene;1,1-dimethylurea
1,2-dichlorobenzene;1,1-dimethylurea (PubChem CID 161139113) has the molecular formula C9H12Cl2N2O
and a molecular weight of 235.11 g/mol. Its IUPAC name is 1,2-dichlorobenzene;1,1-dimethylurea.
Molecular Properties
| Compound Name | 1,2-dichlorobenzene;1,1-dimethylurea |
| PubChem CID | 161139113 |
| Molecular Formula | C9H12Cl2N2O |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 1,2-dichlorobenzene;1,1-dimethylurea |
| SMILES | CN(C)C(N)=O.Clc1ccccc1Cl |
| InChI | InChI=1S/C6H4Cl2.C3H8N2O/c7-5-3-1-2-4-6(5)8;1-5(2)3(4)6/h1-4H;1-2H3,(H2,4,6) |
| InChIKey | UNERATQVYQOLEH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2-dichlorobenzene;1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichlorobenzene;1,1-dimethylurea?
The IUPAC name of 1,2-dichlorobenzene;1,1-dimethylurea (CID 161139113) is 1,2-dichlorobenzene;1,1-dimethylurea.
What is the SMILES notation for 1,2-dichlorobenzene;1,1-dimethylurea?
The canonical SMILES for 1,2-dichlorobenzene;1,1-dimethylurea is CN(C)C(N)=O.Clc1ccccc1Cl.
What is the InChIKey of 1,2-dichlorobenzene;1,1-dimethylurea?
The InChIKey is UNERATQVYQOLEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2.C3H8N2O/c7-5-3-1-2-4-6(5)8;1-5(2)3(4)6/h1-4H;1-2H3,(H2,4,6).
What are the key properties of 1,2-dichlorobenzene;1,1-dimethylurea?
1,2-dichlorobenzene;1,1-dimethylurea has a molecular weight of 235.11 g/mol, XLogP of 2.62, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichlorobenzene;1,1-dimethylurea is sourced from PubChem (CID 161139113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).