About 2-chloroacetyl chloride;1,2-dichlorobenzene
2-chloroacetyl chloride;1,2-dichlorobenzene (PubChem CID 174927592) has the molecular formula C8H6Cl4O
and a molecular weight of 259.95 g/mol. Its IUPAC name is 2-chloroacetyl chloride;1,2-dichlorobenzene.
Molecular Properties
| Compound Name | 2-chloroacetyl chloride;1,2-dichlorobenzene |
| PubChem CID | 174927592 |
| Molecular Formula | C8H6Cl4O |
| Molecular Weight | 259.95 g/mol |
| Exact Mass | 257.92 |
| IUPAC Name | 2-chloroacetyl chloride;1,2-dichlorobenzene |
| SMILES | Clc1ccccc1Cl.O=C(Cl)CCl |
| InChI | InChI=1S/C6H4Cl2.C2H2Cl2O/c7-5-3-1-2-4-6(5)8;3-1-2(4)5/h1-4H;1H2 |
| InChIKey | AWTDADQZIOTQIF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.95 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroacetyl chloride;1,2-dichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroacetyl chloride;1,2-dichlorobenzene?
The IUPAC name of 2-chloroacetyl chloride;1,2-dichlorobenzene (CID 174927592) is 2-chloroacetyl chloride;1,2-dichlorobenzene.
What is the SMILES notation for 2-chloroacetyl chloride;1,2-dichlorobenzene?
The canonical SMILES for 2-chloroacetyl chloride;1,2-dichlorobenzene is Clc1ccccc1Cl.O=C(Cl)CCl.
What is the InChIKey of 2-chloroacetyl chloride;1,2-dichlorobenzene?
The InChIKey is AWTDADQZIOTQIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2.C2H2Cl2O/c7-5-3-1-2-4-6(5)8;3-1-2(4)5/h1-4H;1H2.
What are the key properties of 2-chloroacetyl chloride;1,2-dichlorobenzene?
2-chloroacetyl chloride;1,2-dichlorobenzene has a molecular weight of 259.95 g/mol, XLogP of 3.98, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroacetyl chloride;1,2-dichlorobenzene is sourced from PubChem (CID 174927592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).