About benzene-1,2-diol;2-chloroacetyl chloride
benzene-1,2-diol;2-chloroacetyl chloride (PubChem CID 160709908) has the molecular formula C8H8Cl2O3
and a molecular weight of 223.05 g/mol. Its IUPAC name is benzene-1,2-diol;2-chloroacetyl chloride.
Molecular Properties
| Compound Name | benzene-1,2-diol;2-chloroacetyl chloride |
| PubChem CID | 160709908 |
| Molecular Formula | C8H8Cl2O3 |
| Molecular Weight | 223.05 g/mol |
| Exact Mass | 221.99 |
| IUPAC Name | benzene-1,2-diol;2-chloroacetyl chloride |
| SMILES | O=C(Cl)CCl.Oc1ccccc1O |
| InChI | InChI=1S/C6H6O2.C2H2Cl2O/c7-5-3-1-2-4-6(5)8;3-1-2(4)5/h1-4,7-8H;1H2 |
| InChIKey | RRSJUFLQHBGKHU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.05 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2-diol;2-chloroacetyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-diol;2-chloroacetyl chloride?
The IUPAC name of benzene-1,2-diol;2-chloroacetyl chloride (CID 160709908) is benzene-1,2-diol;2-chloroacetyl chloride.
What is the SMILES notation for benzene-1,2-diol;2-chloroacetyl chloride?
The canonical SMILES for benzene-1,2-diol;2-chloroacetyl chloride is O=C(Cl)CCl.Oc1ccccc1O.
What is the InChIKey of benzene-1,2-diol;2-chloroacetyl chloride?
The InChIKey is RRSJUFLQHBGKHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.C2H2Cl2O/c7-5-3-1-2-4-6(5)8;3-1-2(4)5/h1-4,7-8H;1H2.
What are the key properties of benzene-1,2-diol;2-chloroacetyl chloride?
benzene-1,2-diol;2-chloroacetyl chloride has a molecular weight of 223.05 g/mol, XLogP of 2.09, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-diol;2-chloroacetyl chloride is sourced from PubChem (CID 160709908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).