C10H8Cl4 — CID 12502551
1-chloro-2-[(E)-2,3,4-trichlorobut-2-enyl]benzene (PubChem CID 12502551) has the molecular formula C10H8Cl4 and a molecular weight of 269.99 g/mol. Its IUPAC name is 1-chloro-2-[(E)-2,3,4-trichlorobut-2-enyl]benzene.
| Compound Name | 1-chloro-2-[(E)-2,3,4-trichlorobut-2-enyl]benzene |
|---|---|
| PubChem CID | 12502551 |
| Molecular Formula | C10H8Cl4 |
| Molecular Weight | 269.99 g/mol |
| Exact Mass | 267.94 |
| IUPAC Name | 1-chloro-2-[(E)-2,3,4-trichlorobut-2-enyl]benzene |
| SMILES | ClC/C(Cl)=C(\Cl)Cc1ccccc1Cl |
| InChI | InChI=1S/C10H8Cl4/c11-6-10(14)9(13)5-7-3-1-2-4-8(7)12/h1-4H,5-6H2/b10-9+ |
| InChIKey | QKVNFPOGTVKVMV-MDZDMXLPSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.99 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|