C9H11ClN2O — CID 68799362
2-amino-3-chloro-N,N-dimethylbenzamide (PubChem CID 68799362) has the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. Its IUPAC name is 2-amino-3-chloro-N,N-dimethylbenzamide.
| Compound Name | 2-amino-3-chloro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 68799362 |
| Molecular Formula | C9H11ClN2O |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 2-amino-3-chloro-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(Cl)c1N |
| InChI | InChI=1S/C9H11ClN2O/c1-12(2)9(13)6-4-3-5-7(10)8(6)11/h3-5H,11H2,1-2H3 |
| InChIKey | UJGDNCJNJOEYCV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|